Structure and non-linear optical properties of beta-barium borate

The non-linear optical (NLO) properties of crystalline beta-BaB2O4 (beta-barium borate, BBO) have been investigated from the chemical bond viewpoint. The contributions of each type of chemical bond to the total NLO coefficient have been quantitatively determined. The calculations indicate that the true space group of BBO is R3 rather than R3c.

Synthesis, properties and crystal structure of organic-inorganic radical salt (DBTTF)(6)HPMo12O40 center dot 2H(2)O

Organic-inorganic radical salt (DBTTF)(6)PMo12O40 . 2H(2)O was synthesized by electrocrystallization and characterized by IR spectrum, electronic spectrum and ESR technology, Its magnetic property, conductivity and crystal structure were determined. The title compound crystallized in a triclinic system with P1 space group, a = 1.378 7(7), b = 1.420 4 (2), c = 1.570 2(2) nm, alpha = 104.57(1)degrees, beta = 103.41(2)degrees, gamma = 95.80(2)degrees, V = 2.853(2) nm(3) Z = 1 and a final R = 0.072 7.

The structure and properties of 12-heteropolyacid of molybdenum and tungsten (H3PMo6W6O40) solvated by dimethyl ether

The crystal structure of H3PMo6W6O40 3C2H6O was determined by X-ray crystallography and refined to R = 0.0698 based on 2279 observed reflections to give unit cell parameters a = 16.48(2)Angstrom, c = 25.205(5)Angstrom , gamma = 120 degrees, hexagonal, space group R (3) over bar. The organic solvent molecules were characterized also by IR, H NMR spectra. Weak interaction existed between the organic solvent and the heteropoly acid in the secondary structure. The novel compound showed different behaviours in solubility, oxidizability and photosensitivity in comparison with classical dodeca heteropolyacid of molybdenum and tungsten. (C) 1998 Elsevier Science B.V.

Structure and order of the discotic compound 2,3,6,7,10,11-hexakispentyloxytriphenylene as revealed by diffraction and molecular simulation studies

The aggregate structure of the discotic compound 2,3,6,7,10,11-hexakispentyloxytriphenylene (HPT) was studied both for the crystalline state and the liquid crystalline state by using electron crystallography and a molecular simulation approach. In the crystalline state, HPT was found to adopt an orthorhombic P-2212 space group with cell parameters a = 36.73 Angstrom, b = 27.99 Angstrom and c = 4.91 Angstrom. Molecular packing calculations were conducted to elucidate the molecular conformation and mutual orientational characteristics in the different states. Phase transitions and relationships are discussed from a structural point of view.

Synthesis, structure and properties of alpha-Keggin-type of K6H3[ZnW11O40Al]center dot 9.5H(2)O

A new heteropolycomplex, K6H3[ZnW11O40Al] . 9.5H(2)O was prepared and characterized by means of elemental analysis, IR, UV spectroscopy, Al-27 NMR, electrochemistry and X-ray crystallography. The crystal of K6H3[ZnW11O40Al] . 9.5H(2)O is cubic, space group Fm-3m, with lattice constants a=b=c=2. 144 8(2) nm, V = 9.866(2) nm(3), Mo radiation, R = 0.057 8 for 497 independent data with [I>2 delta(I)]. The anion is of alpha-type Keggin structure with C-s symmetry.

Crystal structure and mechanism of (Z)-1-[2-(phenyl-bromide-chloride)vinyl]-1-cyclohexanol

The crystal structure and mechanism of the title molecule are described. This crystal is orthorhombic, belonging to space group PC21/B with a=1,002 1(2) nm, b=1.483 0(3) nm, c=2.173 6(4) nm, V=3.230 39(2) nm(3), Z=2, D-c=1.80 g/cm(3), R=0.069 3. The structure was solved by direct method. The tin atom of the title compound exists in two distorted-trigonal-bipyramidal geometry, defined by two carbon, one bromide, one chloride and one oxygen atoms leading to a five-membered chelate ring. In the structure, the five-membered ring containing the intermolecular O-->Sn has a half chair conformation.

Synthesis, structure characterization and transesterification of the complexes of beta-alkoxycarbonylethyltin trichlorides

Thirteen title complexes ROCOCH2CH2SnCl3 . L(R = C(1 similar to 5)alkyl;L = DBSO,HMPA) were synthesized and characterized by elemental analysis, IR,H-1 NMR. The crystal structure of n -PrOCOCH2CH2SnCl3 . DBSO was determined by the X-ray diffraction analysis. The crystal belongs to orthorhombic system,space group P2(1)2(1)2(1) with a = 1.062, b = 1.427, c = 1.635nm; Z = 4. The complex exists as a discrete molecule, and the tin atom attains a distorted octahedral geometry via the coordination of intramolecular carbonyl oxygen and the Lewis base donor atom. The transesterification of CH3OCOCH2CH2SnCl3 . L with alcohol was studied, and the intramolecular Lewis acid catalytic mechanism was suggested.

X-ray crystallographic structure of meta- and para-dimethyl ester of pyromellitic acid

The polycrystalline powder of para- and meta-dimethyl ester of pyromellitic acid (PMDE) have been prepared by fractional crystallization, and their crystal structures have been determined by Wide-Angle X-ray Diffraction (WAXD). Both p-PMDE and m-PMDE was found to be orthorhombic crystal system, and their unit cell parameters a = 0.840 nm, b = 0.707 nm, c = 1.136 nm and a = 1.032 nm; b = 0.835 nm, c = 0.714 nm, respectively. Space group all belongs to P-mmm. p-PMDE has two molecules per unit cell with crystal density 1.388 g . cm(-3), while m-PMDE has two molecules per unit cell with crystal density 1.522 g . cm(-3). Indices of crystal diffraction peaks are also detailed in the present work. The difference in crystal structures between p-PMDE and m-PMDE has thus been used to explain the curing behavior of isomerically pyromellitic dianhydride-based poly(amic ester)s.

Isolation and X-ray crystallographic structure of cyclic tetramer based on bisphenol A and o-phthaloyl dichloride

The polycrystalline powder of the cyclic tetramer based on bisphenol A and o-phthaloyldichloride has been prepared by recrystallization from nitrobenzene and its crystal structure has been determined by Wide-Angle X-ray Diffraction (WAXD). The unit cell is orthorhombic and its dimensions a = 0.967 6 nm, b = 0.869 9 nm, c = 2.085 9 nm, Space group belongs to Pmmm, With two tetramers per unit cell,the crystal density is 1.36 g . cm(-3), Indices of crystal diffraction peaks are also detailed in the present work.

The reactivity of lanthanide alkyl compounds with phenylacetylene: Synthesis and structure of [(Bu(t)Cp)(2)LnC CPh](2) (Ln=Nd, Gd)

[(Bu(t)Cp)(2)LnCH(3)](2) (Ln = Nd, Gd) react with PhC=CH to form the dimeric alkynide-bridged complexes [(Bu(t)Cp)(2)LnC=CPh](2) [Ln = Nd (I), Gd (II)]. Both compounds crystallized from toluene in the monoclinic space group C2/c. The two complexes are homologous, composed of asymmetric metal-alkynide bridges with Nd-C, Gd-C (alkynide) bond lengths of 2.602(4), 2.641(5) (I) and 2.532(6), 2.601(7) Angstrom (II), respectively. The average Nd-C (ring) and Gd-C (ring) distances are 2.746(13) and 2.703(19)Angstrom.

Synthesis and structure of 1:1 complex of ethylphenyltin dichloride with N-4-methoxyphenyl-2-hydroxynaphthylideneimine

A novel organotin complex, EtPhSnCl(2) . 2HOC(10)H(6)CH = NC6H1OCH3 was synthesized, and its crystal structure was determined by X-ray diffraction method. The crystal is triclinic, belonging to space group, with unit cell parameters a = 1.150 8(5) nm, b = 1. 153 1(5) gm, c = 1. 004 6 (3) nm, alpha = 94. 15 (3)degrees, beta = 115.47 (3)degrees, r = 85. 94 (4)degrees, V = 1199 7(1) nm(3), Z=2, D-c=1.68 g/cm(3), mu=13. 20 cm(-1), F(000)=618 for 4 131 reflections tions. R=0. 047, R(w)=0. 047. The ligand coordinates to tin atom via phenolic oxygen atom. The complex has a distored trigonal bipyramidal structure, the phenolic oxygen atom of the ligand and one of two chlorine atoms occupy the axial position. The distance between noncoodinated nitrogen atom with phenolic oxygen atom is 0. 257 4 nm, which indicates that the intramolecular hydrogen bond of Schiff base ligand is retained in the complex.

Studies on organolanthanide complexes .58. Syntheses of 1,1'-(3-oxa-pentamethylene)dicyclopentadienyl divalent organolanthanides (Ln=Sm, Yb) and X-ray molecular structure of O(CH2CH2C5H4)(2)Yb(DME)

The compounds O(CH2CH2C5H4)(2)Ln(THF)(2) [Ln = Sm(1), Yb(2)] were synthesized by the reduction of O(CH2CH2C5H4)(2)LnCl with sodium metal in tetrahydrofuran (THF) at room temperature. Recrystallization of 2 from dimethoxyethane (DME) produced the single-crystal O(CH2CH2C5H4)(2)Yb(DME) (3) whose structure has been determined by an X-ray diffraction study. The crystals are orthorhombic, space group Pcab, with a = 14.168(4), b = 13.541(6), c = 19.314(8) Angstrom, Z = 8, D-calc. = 1.66 g cm(-3).

Crystal and molecular structure of the complex of methoxycarbonylethyltin trichloride with salicylidene-m-toluidine

The synthesis and properties of the title complex CH3OCOCH2CH2SnCl3.2-HOC6H4CH=NC6H4-3'-CH3 are described. It crystallizes from benzene in the monoclinic space group P2(1/n) with unit cell dimensions a=10.326 (C),b=6.815(8), c=12.931(6) Angstrom, beta =111.52(3,)degrees, V=2088.7(1) Angstrom (3), Z=4, F(000) =1040, mu =16.31 cm(-1), Dc=1. 67g/cm(3) final R factor is 0.037 for 3177 observed reflections, 1 greater than or equal to3 sigma (1(0)). The tin atom in the structure of the complex exists in a distored octahedral geometry defined by three Cl atoms, the C and O atoms of a chelating methoxycarbonylethyl. group as well as an O atom derived from the Schiff base ligand.

CRYSTAL-STRUCTURE OF [YB (NO3)3 (PHEN) (H2O)]CENTER-DOT(12-CROWN-4)

The title complex was prepared by reacting Yb(NO3)3 (12-crown-4) with 1, 10-phenanthiroline (hereafter phen) in acetone. It crystallized in the triclinic space group P1BAR with a = 10.095(5), b = 17.415(4), c = 8.710(2) angstrom; alpha = 92.45(2), beta = 115.83(3), gamma = 74.08(3)degrees and D(c), = 1.85 g cm-3; Z = 2. The metal ion in this complex is nine-coordinated to three bidentate nitrate ions, two nitrogen atoms of a phen and a water molecule. The crown ligand is hydrogen bonded to the coordination water molecule. The symmetry change of the crown ether is also discussed.

SYNTHESIS AND CRYSTAL-STRUCTURE OF [(ME4C2CP2SMCL.MGCL2.3THF)THF]2

[(Me4C2Cp2SmCl.MgCl2.3THF)THF]2 was prepared by the reaction of Me4C2Cp2MgCl2.4THF (Cp=C5H4, THF = tetrahydrofuran) with SmCl3 in THF. The crystals belong to triclinic space group P-1 with a 12.149(3), b 13.187(4), c 13.810(5) angstrom, alpha 117.23(2), beta 94.07(2), gamma 62.86(2)-degrees, V = 1723.9(1.0) angstrom3. In the molecular structure of the title compound there is a symmetrical centre and a quadrilateral formed by SM, Mg, Cl1, Cl2 atoms. Two centroids of the cyclopentadienyls, bridged by a tetramethylethano group form with three bridging chlorine atoms (Cl1, Cl2, Cl1a) a pseudo-trigonal bipyramid around Sm. Three oxygen atoms of THF and three chlorine atoMS (Cl1, Cl2, Cl3) constitute a distorted octahedron around Mg.