3 resultados para P System
em Chinese Academy of Sciences Institutional Repositories Grid Portal
Resumo:
Liquid polybutadiene with desirable 1,2-units content was synthesized by Co(naph)(2)-Al-2(C2H5)(3)Cl-3-P(OPh)(3) catalyst system. It was shown that liquid polybutadiene having adequate 1,2-unit content (vinvl =35%-40%) molecular weight(M-n = 700-3500), and acceptabele conversion(>= 55%) can synthesized after optimizing polymerization conditions.
Resumo:
Oxochromium (V) tetraphenylporphyrin complexes, O = Cr (V) TPP (Cl) PhI. O = Cr-(V) TPP (N3) PhI and O = Cr (V)TPP (p-CH3OC6H4O)1/2PhI were isolated from the reaction of Cr (III) TPP (Cl). Cr (III) TPP (N3) Py or Cr (III) TPP (p-CH3OC6H4O) THF with iodosy